Mesquitol: Difference between revisions
Content deleted Content added
حسن علي البط (talk | contribs) m Adding category Category:Catechols (using HotCat) |
pic, PC |
||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Name = Mesquitol |
| Name = Mesquitol |
||
| ImageFile = Mesquitol. |
| ImageFile = Mesquitol.svg |
||
| ImageSize = |
| ImageSize = 250px |
||
| ImageName = Chemical structure of mesquitol |
| ImageName = Chemical structure of mesquitol |
||
| IUPACName = 3,4-Dihydro-2alpha- (3,4-dihydroxyphenyl) -2H-1-benzopyran-3beta,7,8-triol |
| IUPACName = 3,4-Dihydro-2alpha- (3,4-dihydroxyphenyl) -2H-1-benzopyran-3beta,7,8-triol |
||
| Line 10: | Line 10: | ||
| CASNo_Ref = |
| CASNo_Ref = |
||
| CASOther = |
| CASOther = |
||
| PubChem = |
| PubChem = 11033582 |
||
| SMILES = Oc(c3)c(O)cc(c3)C(O1)C(O)Cc(c2)c1c(O)c(O)c2 |
| SMILES = Oc(c3)c(O)cc(c3)C(O1)C(O)Cc(c2)c1c(O)c(O)c2 |
||
| InChI = |
| InChI = |
||
Revision as of 19:39, 22 October 2010
| |
| Names | |
|---|---|
| IUPAC name
3,4-Dihydro-2alpha- (3,4-dihydroxyphenyl) -2H-1-benzopyran-3beta,7,8-triol
| |
| Other names
(-)-mesquitol
| |
| Identifiers | |
3D model (JSmol)
|
|
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| Properties | |
| C15H14O6 | |
| Molar mass | 290.26 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Mesquitol is a flavan-3ol, a type of flavonoid[1].
Prosopis juliflora, a tree found in Kenya, shows unusual amount of (-)-mesquitol from its heartwood[2].
References
 | This article about an aromatic compound is a stub. You can help Wikipedia by expanding it. |